9-acridinol, 6-amino-2-ethoxy-
6-amino-2-ethoxyacridin-9(10H)-one
CAS: 144335-20-6
Molecular Formula: C15H14N2O2
9-acridinol, 6-amino-2-ethoxy- - Names and Identifiers
| Name | 6-amino-2-ethoxyacridin-9(10H)-one |
| Synonyms | 6-amino-2-ethoxyacridin-9-ol 9-acridinol, 6-amino-2-ethoxy- 6-amino-2-ethoxy-10h-acridin-9-one 6-amino-2-ethoxyacridin-9(10H)-one 6-Amino-2-ethoxyacridin-9(10H)-one 9(10H)-Acridinone, 6-amino-2-ethoxy- 9(10H)-Acridinone, 6-aMino-2-ethoxy- |
| CAS | 144335-20-6 |
| InChI | InChI=1/C15H14N2O2/c1-2-19-10-4-6-13-12(8-10)15(18)11-5-3-9(16)7-14(11)17-13/h3-8H,2,16H2,1H3,(H,17,18) |
9-acridinol, 6-amino-2-ethoxy- - Physico-chemical Properties
| Molecular Formula | C15H14N2O2 |
| Molar Mass | 254.28386 |
| Density | 1.262g/cm3 |
| Boling Point | 490.4°C at 760 mmHg |
| Flash Point | 250.4°C |
| Vapor Presure | 9.19E-10mmHg at 25°C |
| Refractive Index | 1.642 |
9-acridinol, 6-amino-2-ethoxy- - Introduction
6-amino-2-ethoxyacridin-9(10h)-one, also known as AEEA, is an organic compound. Its nature is as follows:
1. Appearance: AEEA is a colorless crystalline solid.
2. Solubility: AEEA has low solubility in water and is easily dissolved in regular solvents.
3. Melting point: The melting point of AEEA is about 50-60 degrees Celsius.
Use:
AEEA has certain application value in chemical and pharmaceutical industries.
1. Active reagent: AEEA can be used as a reagent in organic synthesis for the preparation of various amino-containing compounds.
2. Drug intermediates: AEEA can be used as intermediates in the synthesis of some drugs, such as antibiotics and anticancer drugs.
Method:
The synthesis method of AEEA can be carried out by the following steps:
First, acridine is used as a starting material to react with amino acid to generate the corresponding amide compound. The amide is then subjected to an amide hydrolysis reaction to give the corresponding acid. Finally, the acid is reacted with ethanol to give 6-amino-2-ethoxyacridin-9(10h)-one.
Safety Information:
Note the following when using AEEA:
1. Because AEEA has a certain irritation, the operation should wear appropriate protective gloves and glasses, avoid contact with skin and eyes.
2. AEEA should pay attention to fire prevention and avoid exposure to high temperature environment during storage and use.
3. When using AEEA, it should be operated in a well-ventilated laboratory or space to ensure safety.
It is important to note that the specific properties, uses, manufacturing methods and safety information of the chemical may require further verification and detailed understanding. In practical application, the relevant regulations and safety operation guidelines for chemicals should be followed.
1. Appearance: AEEA is a colorless crystalline solid.
2. Solubility: AEEA has low solubility in water and is easily dissolved in regular solvents.
3. Melting point: The melting point of AEEA is about 50-60 degrees Celsius.
Use:
AEEA has certain application value in chemical and pharmaceutical industries.
1. Active reagent: AEEA can be used as a reagent in organic synthesis for the preparation of various amino-containing compounds.
2. Drug intermediates: AEEA can be used as intermediates in the synthesis of some drugs, such as antibiotics and anticancer drugs.
Method:
The synthesis method of AEEA can be carried out by the following steps:
First, acridine is used as a starting material to react with amino acid to generate the corresponding amide compound. The amide is then subjected to an amide hydrolysis reaction to give the corresponding acid. Finally, the acid is reacted with ethanol to give 6-amino-2-ethoxyacridin-9(10h)-one.
Safety Information:
Note the following when using AEEA:
1. Because AEEA has a certain irritation, the operation should wear appropriate protective gloves and glasses, avoid contact with skin and eyes.
2. AEEA should pay attention to fire prevention and avoid exposure to high temperature environment during storage and use.
3. When using AEEA, it should be operated in a well-ventilated laboratory or space to ensure safety.
It is important to note that the specific properties, uses, manufacturing methods and safety information of the chemical may require further verification and detailed understanding. In practical application, the relevant regulations and safety operation guidelines for chemicals should be followed.
Last Update：2024-04-09 21:04:16
